EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53579 - pholcodine
| Formula | C23H30N2O4 |
| Net Charge | 0 |
| Average Mass | 398.503 |
| Monoisotopic Mass | 398.22056 |
| SMILES | [H][C@@]12C=C[C@H](O)[C@]3([H])Oc4c(OCCN5CCOCC5)ccc5c4[C@]13CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C23H30N2O4/c1-24-7-6-23-16-3-4-18(26)22(23)29-21-19(5-2-15(20(21)23)14-17(16)24)28-13-10-25-8-11-27-12-9-25/h2-5,16-18,22,26H,6-14H2,1H3/t16-,17+,18-,22-,23-/m0/s1 |
| InChIKey | GPFAJKDEDBRFOS-FKQDBXSBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. drug allergen Any drug which causes the onset of an allergic reaction. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pholcodine (CHEBI:53579) has role antitussive (CHEBI:51177) |
| pholcodine (CHEBI:53579) has role drug allergen (CHEBI:88188) |
| pholcodine (CHEBI:53579) has role opioid analgesic (CHEBI:35482) |
| pholcodine (CHEBI:53579) has role μ-opioid receptor agonist (CHEBI:55322) |
| pholcodine (CHEBI:53579) is a morphinane alkaloid (CHEBI:25418) |
| pholcodine (CHEBI:53579) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (5α,6α)-17-methyl-3-[2-(morpholin-4-yl)ethoxy]-7,8-didehydro-4,5-epoxymorphinan-6-ol |
| INNs | Source |
|---|---|
| pholcodine | KEGG DRUG |
| folcodina | ChemIDplus |
| pholcodinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(2-(4-Morpholinyl)ethyl)morphine | ChemIDplus |
| 3-Morpholyläthylmorphin | ChemIDplus |
| 7,8-Didehydro-4,5-alpha-epoxy-17-methyl-3-(2-morpholinoethoxy)morphinan-6-alpha-ol | ChemIDplus |
| Tetrahydro-1,4-oxazinylmethylcodeine | ChemIDplus |
| beta-Morpholinoethylmorphine | ChemIDplus |
| 3-(2-Morpholinoethyl)morphine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| D07385 | KEGG DRUG |
| Pholcodine | Wikipedia |
| 2154 | DrugCentral |
| Citations |
|---|