EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6N2O2 |
| Net Charge | 0 |
| Average Mass | 174.159 |
| Monoisotopic Mass | 174.04293 |
| SMILES | Cc1c(N=C=O)cccc1N=C=O |
| InChI | InChI=1S/C9H6N2O2/c1-7-8(10-5-12)3-2-4-9(7)11-6-13/h2-4H,1H3 |
| InChIKey | RUELTTOHQODFPA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| toluene 2,6-diisocyanate (CHEBI:53557) has role allergen (CHEBI:50904) |
| toluene 2,6-diisocyanate (CHEBI:53557) has role hapten (CHEBI:59174) |
| toluene 2,6-diisocyanate (CHEBI:53557) is a toluene meta-diisocyanate (CHEBI:53555) |
| IUPAC Name |
|---|
| 1,3-diisocyanato-2-methylbenzene |
| Synonyms | Source |
|---|---|
| 2,6-Diisocyanato-1-methylbenzene | ChemIDplus |
| 2,6-Diisocyanatotoluene | ChemIDplus |
| 2,6-TDI | ChEBI |
| 2,6-Toluene diisocyanate | ChemIDplus |
| 2-Methyl-meta-phenylene isocyanate | ChemIDplus |
| Isocyanic acid, 2-methyl-meta-phenylene ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Toluene_diisocyanate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2211546 | Reaxys |
| CAS:91-08-7 | ChemIDplus |
| Citations |
|---|