EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6N2O2 |
| Net Charge | 0 |
| Average Mass | 174.159 |
| Monoisotopic Mass | 174.04293 |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O |
| InChI | InChI=1S/C9H6N2O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13/h2-4H,1H3 |
| InChIKey | DVKJHBMWWAPEIU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| toluene 2,4-diisocyanate (CHEBI:53556) has role allergen (CHEBI:50904) |
| toluene 2,4-diisocyanate (CHEBI:53556) has role hapten (CHEBI:59174) |
| toluene 2,4-diisocyanate (CHEBI:53556) is a toluene meta-diisocyanate (CHEBI:53555) |
| IUPAC Name |
|---|
| 2,4-diisocyanato-1-methylbenzene |
| Synonyms | Source |
|---|---|
| 2,4-Diisocyanatotoluene | ChemIDplus |
| 2,4-TDI | ChemIDplus |
| 2,4-Toluene diisocyanate | ChemIDplus |
| 2,4-Tolylene diisocyanate | ChemIDplus |
| 4-Methyl-m-phenylene diisocyanate | ChemIDplus |
| Isocyanic acid, 4-methyl-m-phenylene ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Toluene_diisocyanate | Wikipedia |
| Citations |
|---|