EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12As2N2O6 |
| Net Charge | 0 |
| Average Mass | 430.080 |
| Monoisotopic Mass | 429.91273 |
| SMILES | O=[As](O)(O)c1ccc(/N=N/c2ccc([As](=O)(O)O)cc2)cc1 |
| InChI | InChI=1S/C12H12As2N2O6/c17-13(18,19)9-1-5-11(6-2-9)15-16-12-7-3-10(4-8-12)14(20,21)22/h1-8H,(H2,17,18,19)(H2,20,21,22)/b16-15+ |
| InChIKey | ITRMROGJSNWFKO-FOCLMDBBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-azodibenzenearsonic acid (CHEBI:53554) has functional parent arsanilic acid (CHEBI:49477) |
| 4,4'-azodibenzenearsonic acid (CHEBI:53554) has role allergen (CHEBI:50904) |
| 4,4'-azodibenzenearsonic acid (CHEBI:53554) has role hapten (CHEBI:59174) |
| 4,4'-azodibenzenearsonic acid (CHEBI:53554) is a monoazo compound (CHEBI:48959) |
| 4,4'-azodibenzenearsonic acid (CHEBI:53554) is a organoarsonic acid (CHEBI:22638) |
| IUPAC Name |
|---|
| [(E)-diazene-1,2-diyldibenzene-4,1-diyl]bis(arsonic acid) |
| Synonyms | Source |
|---|---|
| p-Azobenzenearsonate | ChemIDplus |
| Azophenylarsonate | ChemIDplus |
| para-Azobenzenearsonate | ChemIDplus |
| p-azophenylarsonate | ChEBI |
| ABA | ChEBI |
| p-ABA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| P-Azobenzenearsonate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3161641 | Reaxys |
| CAS:7334-23-8 | ChemIDplus |
| Citations |
|---|