EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3N3O9S |
| Net Charge | 0 |
| Average Mass | 293.169 |
| Monoisotopic Mass | 292.95900 |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(S(=O)(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3N3O9S/c10-7(11)3-1-5(9(14)15)6(19(16,17)18)2-4(3)8(12)13/h1-2H,(H,16,17,18) |
| InChIKey | HUPDIVYMUZMPMO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,5-trinitrobenzenesulfonic acid (CHEBI:53506) has role hapten (CHEBI:59174) |
| 2,4,5-trinitrobenzenesulfonic acid (CHEBI:53506) is a C-nitro compound (CHEBI:35716) |
| 2,4,5-trinitrobenzenesulfonic acid (CHEBI:53506) is a arenesulfonic acid (CHEBI:33555) |
| IUPAC Name |
|---|
| 2,4,5-trinitrobenzenesulfonic acid |
| Synonyms | Source |
|---|---|
| 2,4,5-Trinitrobenzolsulfonsäure | ChEBI |
| trinitrobenzene sulfonic acid | ChEBI |
| trinitrobenzenesulfonic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2775827 | Reaxys |
| Citations |
|---|