EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O5 |
| Net Charge | -1 |
| Average Mass | 183.139 |
| Monoisotopic Mass | 183.02990 |
| SMILES | O=C([O-])C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H8O5/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,9-11H,(H,12,13)/p-1 |
| InChIKey | RGHMISIYKIHAJW-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxymandelate (CHEBI:53326) has role human metabolite (CHEBI:77746) |
| 3,4-dihydroxymandelate (CHEBI:53326) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 3,4-dihydroxymandelate (CHEBI:53326) is conjugate base of 3,4-dihydroxymandelic acid (CHEBI:27637) |
| Incoming Relation(s) |
| (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetate (CHEBI:180944) is a 3,4-dihydroxymandelate (CHEBI:53326) |
| 3,4-dihydroxymandelic acid (CHEBI:27637) is conjugate acid of 3,4-dihydroxymandelate (CHEBI:53326) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-2-hydroxyacetate |
| Synonym | Source |
|---|---|
| (3,4-dihydroxyphenyl)(hydroxy)acetate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10550858 | Reaxys |