EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C6H7N3O11)n.C12H14N8O27 |
| Net Charge | 0 |
| Average Mass | 999.405 |
| Monoisotopic Mass | 999.00490 |
| SMILES | O=[N+]([O-])OC[C@H]1O[C@@H](O[C@H]2[C@H](O[N+](=O)[O-])[C@@H](O[N+](=O)[O-])[C@H](O[N+](=O)[O-])O[C@@H]2CO[N+](=O)[O-])[C@H](O[N+](=O)[O-])[C@@H](O[N+](=O)[O-])[C@@H]1O[C@@H]1O[C@H](CO[N+](=O)[O-])[C@@H](O[N+](=O)[O-])[C@H](O[N+](=O)[O-])[C@H]1O[N+](=O)[O-] |
| WURCS | WURCS=2.0/3,3,2/[a2122h-1b_1-5_1*ONO/3=O_2*ONO/3=O_3*ONO/3=O_6*ONO/3=O][a2122h-1b_1-5_2*ONO/3=O_3*ONO/3=O_6*ONO/3=O][a2122h-1b_1-5_2*ONO/3=O_3*ONO/3=O_4*ONO/3=O_6*ONO/3=O]/1-2-3/a4-b1_b4-c1 |
| InChI | InChI=1S/C18H21N11O38/c30-19(31)52-1-4-7(58-17-14(65-27(46)47)12(63-25(42)43)9(60-22(36)37)6(56-17)3-54-21(34)35)10(61-23(38)39)13(64-26(44)45)16(55-4)59-8-5(2-53-20(32)33)57-18(67-29(50)51)15(66-28(48)49)11(8)62-24(40)41/h4-18H,1-3H2/t4-,5-,6-,7-,8-,9-,10+,11+,12+,13-,14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | FJWGYAHXMCUOOM-QHOUIDNNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| Biological Role: | tissue adhesive A substance used to cause adherence of tissue to tissue or tissue to non-tissue surfaces, as for prostheses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrocellulose (CHEBI:53325) has functional parent (1→4)-β-D-glucan (CHEBI:18246) |
| nitrocellulose (CHEBI:53325) has role explosive (CHEBI:63490) |
| nitrocellulose (CHEBI:53325) has role tissue adhesive (CHEBI:53337) |
| nitrocellulose (CHEBI:53325) is a β-D-glucan (CHEBI:28793) |
| INNs | Source |
|---|---|
| Piroxilina | ChemIDplus |
| Pyroxylin | ChemIDplus |
| Pyroxyline | ChemIDplus |
| Pyroxylinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cellulose nitrate | ChemIDplus |
| Cellulose tetranitrate | ChemIDplus |
| Collodion | ChemIDplus |
| gun cotton | ChEBI |
| Nitrocellulose | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Nitrocellulose | Wikipedia |