EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C6H7O6)n.H2NaO |
| Net Charge | 0 |
| Average Mass | 216.121 |
| Monoisotopic Mass | 216.02460 |
| SMILES | [H]O[C@@H]1C(C(=O)[O-])O[C@@H](O)[C@@H](O)[C@H]1O.[Na+] |
| InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1-,2-,3-,4?,6+;/m0./s1 |
| InChIKey | MSXHSNHNTORCAW-MPGIDXPLSA-M |
| Roles Classification |
|---|
| Application: | hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium alginate (CHEBI:53311) has part alginate (CHEBI:58187) |
| sodium alginate (CHEBI:53311) has role hematologic agent (CHEBI:50248) |
| sodium alginate (CHEBI:53311) is a copolymer macromolecule (CHEBI:53310) |
| sodium alginate (CHEBI:53311) is a organic sodium salt (CHEBI:38700) |
| Synonyms | Source |
|---|---|
| Algiline | ChemIDplus |
| Algin | ChemIDplus |
| Alginic acid, sodium salt | ChEMBL |
| Arcrane | KEGG DRUG |
| Ascophyllum | KEGG DRUG |
| E-401 | ChEMBL |
| Brand Name | Source |
|---|---|
| Sodium alginate component of ntx-1 | ChEMBL |