EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC(C)=CCC/C(C)=C/C=O |
| InChI | InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7+ |
| InChIKey | WTEVQBCEXWBHNA-JXMROGBWSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranial (CHEBI:16980) has role plant metabolite (CHEBI:76924) |
| geranial (CHEBI:16980) has role volatile oil component (CHEBI:27311) |
| geranial (CHEBI:16980) is a enal (CHEBI:51688) |
| geranial (CHEBI:16980) is a monoterpenoid (CHEBI:25409) |
| geranial (CHEBI:16980) is a polyprenal (CHEBI:137934) |
| Incoming Relation(s) |
| 2,3-epoxygerianial (CHEBI:67258) has functional parent geranial (CHEBI:16980) |
| citral (CHEBI:23316) has part geranial (CHEBI:16980) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dienal |
| Synonyms | Source |
|---|---|
| alpha-Citral | ChemIDplus |
| citral A | ChEBI |
| (E)-Citral | ChemIDplus |
| (E)-Geranial | ChemIDplus |
| Geranial | KEGG COMPOUND |
| lemonal | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E)-geranial | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003035 | KNApSAcK |
| C01499 | KEGG COMPOUND |
| GERANIAL | MetaCyc |
| HMDB0035078 | HMDB |
| LMPR0102010003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721873 | Reaxys |
| CAS:141-27-5 | KEGG COMPOUND |
| CAS:141-27-5 | ChemIDplus |
| CAS:5392-40-5 | KEGG COMPOUND |
| Citations |
|---|