EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1cc(-c2cc(=O)c3ccc(O)cc3o2)ccc1O |
| InChI | InChI=1S/C16H12O5/c1-20-16-6-9(2-5-12(16)18)14-8-13(19)11-4-3-10(17)7-15(11)21-14/h2-8,17-18H,1H3 |
| InChIKey | OUMMPAFEQHTYIZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Albizia julibrissin (ncbitaxon:3813) | bark (BTO:0001301) | PubMed (15283458) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geraldone (CHEBI:5326) has functional parent 4',5,7-trihydroxy-3'-methoxyflavone (CHEBI:16514) |
| geraldone (CHEBI:5326) has role plant metabolite (CHEBI:76924) |
| geraldone (CHEBI:5326) is a dihydroxyflavone (CHEBI:38686) |
| geraldone (CHEBI:5326) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| 7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 5-Deoxychrysoeriol | KEGG COMPOUND |
| 7,4'-dihydroxy-3'-methoxyflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00003826 | KNApSAcK |
| C10047 | KEGG COMPOUND |
| LMPK12110043 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1256759 | Reaxys |
| CAS:21583-32-4 | KEGG COMPOUND |
| Citations |
|---|