EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | COc1cc(O)c2c(=O)c3cc(O)ccc3oc2c1 |
| InChI | InChI=1S/C14H10O5/c1-18-8-5-10(16)13-12(6-8)19-11-3-2-7(15)4-9(11)14(13)17/h2-6,15-16H,1H3 |
| InChIKey | XOXYHGOIRWABTC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana lutea (ncbitaxon:38851) | root (BTO:0001188) | PubMed (18064621) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentisin (CHEBI:5324) has role plant metabolite (CHEBI:76924) |
| gentisin (CHEBI:5324) is a aromatic ether (CHEBI:35618) |
| gentisin (CHEBI:5324) is a polyphenol (CHEBI:26195) |
| gentisin (CHEBI:5324) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,7-dihydroxy-3-methoxy-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,7-Dihydroxy-3-methoxyxanthone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002954 | KNApSAcK |
| C10066 | KEGG COMPOUND |
| HMDB0031760 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:384788 | Reaxys |
| CAS:437-50-3 | KEGG COMPOUND |
| Citations |
|---|