EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O5 |
| Net Charge | 0 |
| Average Mass | 244.202 |
| Monoisotopic Mass | 244.03717 |
| SMILES | O=c1c2cc(O)ccc2oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C13H8O5/c14-6-1-2-10-8(3-6)13(17)12-9(16)4-7(15)5-11(12)18-10/h1-5,14-16H |
| InChIKey | JJUNZBRHHGLJQW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum annulatum (ncbitaxon:708052) | - | PubMed (17260692) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentisein (CHEBI:5323) has role plant metabolite (CHEBI:76924) |
| gentisein (CHEBI:5323) is a polyphenol (CHEBI:26195) |
| gentisein (CHEBI:5323) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3,7-trihydroxy-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,3,7-Trihydroxyxanthone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002953 | KNApSAcK |
| C10065 | KEGG COMPOUND |
| HMDB0029463 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:384687 | Reaxys |
| CAS:529-49-7 | ChemIDplus |
| CAS:529-49-7 | KEGG COMPOUND |
| Citations |
|---|