EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O |
| Net Charge | 0 |
| Average Mass | 192.302 |
| Monoisotopic Mass | 192.15142 |
| SMILES | C/C=C/C(=O)C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7-8,12H,6,9H2,1-4H3/b7-5+ |
| InChIKey | CRIGTVCBMUKRSL-FNORWQNLSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-enone (CHEBI:53220) has role allergen (CHEBI:50904) |
| 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-enone (CHEBI:53220) has role fragrance (CHEBI:48318) |
| 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-enone (CHEBI:53220) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| (2E)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-en-1-one |
| Synonyms | Source |
|---|---|
| 1-(2,6,6-trimethyl-2-cyclohexen-1-yl)-2-butenone | ChEBI |
| 1-(2,6,6-trimethyl-2-cyclohexen-1-yl)-trans-2-Buten-1-one | ChemIDplus |
| 4-(2,6,6-Trimethyl-2-cyclohexenyl)-2-buten-4-one | ChemIDplus |
| alpha-Damascone | ChemIDplus |
| TMCHB | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| KR20080008859 | Patent |
| US2008096790 | Patent |
| US4990496 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2208707 | Reaxys |
| CAS:43052-87-5 | ChemIDplus |
| Citations |
|---|