EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53217 - citranaxanthin
| Formula | C33H44O |
| Net Charge | 0 |
| Average Mass | 456.714 |
| Monoisotopic Mass | 456.33922 |
| SMILES | CC(=O)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C33H44O/c1-26(16-11-18-28(3)21-23-31(6)34)14-9-10-15-27(2)17-12-19-29(4)22-24-32-30(5)20-13-25-33(32,7)8/h9-12,14-19,21-24H,13,20,25H2,1-8H3/b10-9+,16-11+,17-12+,23-21+,24-22+,26-14+,27-15+,28-18+,29-19+ |
| InChIKey | PRDJTOVRIHGKNU-ZWERVMMHSA-N |
| Roles Classification |
|---|
| Biological Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Application: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citranaxanthin (CHEBI:53217) has role food colouring (CHEBI:77182) |
| citranaxanthin (CHEBI:53217) is a apo carotenoid (CHEBI:53183) |
| citranaxanthin (CHEBI:53217) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| (3E,5E,7E,9E,11E,13E,15E,17E,19E)-5,9,14,18-tetramethyl-20-(2,6,6-trimethylcyclohex-1-en-1-yl)icosa-3,5,7,9,11,13,15,17,19-nonaen-2-one |
| Synonyms | Source |
|---|---|
| (E)-5,9,14,18-Tetramethyl-20-(2,6,6-trimethylcyclohexenyl)-3,5,7,9,11,13,15,17,19-icosanonaen-2-one | ChemIDplus |
| E 161i | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2019740 | Beilstein |
| CAS:3604-90-8 | ChemIDplus |
| Citations |
|---|