EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O2 |
| Net Charge | 0 |
| Average Mass | 262.353 |
| Monoisotopic Mass | 262.16813 |
| SMILES | O=C=NC1CCC(CC2CCC(N=C=O)CC2)CC1 |
| InChI | InChI=1S/C15H22N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h12-15H,1-9H2 |
| InChIKey | KORSJDCBLAPZEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicyclohexylmethane-4,4'-diisocyanate (CHEBI:53216) has role allergen (CHEBI:50904) |
| dicyclohexylmethane-4,4'-diisocyanate (CHEBI:53216) is a diisocyanate (CHEBI:53213) |
| IUPAC Name |
|---|
| 1,1'-methylenebis(4-isocyanatocyclohexane) |
| Synonyms | Source |
|---|---|
| 4,4'-Diisocyanatodicyclohexylmethane | ChemIDplus |
| Hydrogenated MDI | ChemIDplus |
| Hylene W | ChemIDplus |
| Methylene bis(4-cyclohexylisocyanate) | ChemIDplus |
| Methylene bis-(4-cyclohexylisocyanate) | ChemIDplus |
| HMDI | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US2011021810 | Patent |
| Citations |
|---|