EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O2 |
| Net Charge | 0 |
| Average Mass | 568.886 |
| Monoisotopic Mass | 568.42803 |
| SMILES | CC(=O)CCCC(C)(C)C(=O)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H56O2/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38(42)40(9,10)30-16-24-36(6)41/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | PDBIWYOLPQXSTF-JLTXGRSLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| semi-β-carotenone (CHEBI:53215) has role plant metabolite (CHEBI:76924) |
| semi-β-carotenone (CHEBI:53215) is a carotenone (CHEBI:35310) |
| semi-β-carotenone (CHEBI:53215) is a diketone (CHEBI:46640) |
| semi-β-carotenone (CHEBI:53215) is a enone (CHEBI:51689) |
| semi-β-carotenone (CHEBI:53215) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| (8E,10E,12E,14E,16E,18E,20E,22E,24E)-6,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohex-1-en-1-yl)pentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039017 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3185633 | Reaxys |
| Citations |
|---|