EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O2 |
| Net Charge | 0 |
| Average Mass | 222.288 |
| Monoisotopic Mass | 222.13683 |
| SMILES | CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C12H18N2O2/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15/h10H,4-7H2,1-3H3 |
| InChIKey | NIMLQBUJDJZYEJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isophorone diisocyanate (CHEBI:53214) has functional parent isophorone (CHEBI:34800) |
| isophorone diisocyanate (CHEBI:53214) is a diisocyanate (CHEBI:53213) |
| IUPAC Name |
|---|
| 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| Synonyms | Source |
|---|---|
| 3-Isocyanatomethyl-3,5,5-trimethylcyclohexylisocyanate | ChemIDplus |
| IPDI | ChemIDplus |
| Isocyanic acid, methylene(3,5,5-trimethyl-3,1-cyclohexylene) ester | ChemIDplus |
| Isophorone diamine diisocyanate | ChemIDplus |
| Isophorone diisocyanate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Isophorone_diisocyanate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:4098-71-9 | ChemIDplus |
| Citations |
|---|