EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H40 |
| Net Charge | 0 |
| Average Mass | 268.529 |
| Monoisotopic Mass | 268.31300 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C19H40/c1-16(2)10-7-12-18(5)14-9-15-19(6)13-8-11-17(3)4/h16-19H,7-15H2,1-6H3 |
| InChIKey | XOJVVFBFDXDTEG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. |
| Applications: | immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pristane (CHEBI:53181) has role biomarker (CHEBI:59163) |
| pristane (CHEBI:53181) has role immunological adjuvant (CHEBI:50847) |
| pristane (CHEBI:53181) is a long-chain alkane (CHEBI:83563) |
| pristane (CHEBI:53181) is a norterpene (CHEBI:53182) |
| IUPAC Name |
|---|
| 2,6,10,14-tetramethylpentadecane |
| Synonyms | Source |
|---|---|
| Bute hydrocarbon | ChemIDplus |
| Norphytan | NIST Chemistry WebBook |
| Norphytane | ChemIDplus |
| Pristan | NIST Chemistry WebBook |
| Citations |
|---|