EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O2 |
| Net Charge | 0 |
| Average Mass | 366.545 |
| Monoisotopic Mass | 366.25588 |
| SMILES | [H]C(=O)/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C25H34O2/c1-19(10-7-8-11-21(3)18-26)12-9-13-20(2)14-15-24-22(4)16-23(27)17-25(24,5)6/h7-15,18,23,27H,16-17H2,1-6H3/b8-7+,12-9+,15-14+,19-10+,20-13+,21-11+/t23-/m1/s1 |
| InChIKey | PAUIQDPAEDELMC-HEZGKBSMSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-hydroxy-12'-apo-β-carotenal (CHEBI:53161) has role plant metabolite (CHEBI:76924) |
| (3R)-3-hydroxy-12'-apo-β-carotenal (CHEBI:53161) is a apo carotenoid C25 terpenoid (CHEBI:53184) |
| (3R)-3-hydroxy-12'-apo-β-carotenal (CHEBI:53161) is a enal (CHEBI:51688) |
| IUPAC Name |
|---|
| (3R)-8'-apo-β-caroten-12'-al-3-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4787373 | Reaxys |
| Citations |
|---|