EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40O2 |
| Net Charge | 0 |
| Average Mass | 432.648 |
| Monoisotopic Mass | 432.30283 |
| SMILES | [H]C(=O)/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C30H40O2/c1-23(12-8-9-13-24(2)15-11-17-26(4)22-31)14-10-16-25(3)18-19-29-27(5)20-28(32)21-30(29,6)7/h8-19,22,28,32H,20-21H2,1-7H3/b9-8+,14-10+,15-11+,19-18+,23-12+,24-13+,25-16+,26-17+/t28-/m1/s1 |
| InChIKey | AVPAEFHIEZLSLZ-QCPGYTKSSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-hydroxy-8'-apo-β-carotenal (CHEBI:53159) has role plant metabolite (CHEBI:76924) |
| (3R)-3-hydroxy-8'-apo-β-carotenal (CHEBI:53159) is a apo carotenoid triterpenoid (CHEBI:36783) |
| (3R)-3-hydroxy-8'-apo-β-carotenal (CHEBI:53159) is a enal (CHEBI:51688) |
| IUPAC Name |
|---|
| (3R)-3-hydroxy-8'-apo-β-caroten-8'-al |
| Synonyms | Source |
|---|---|
| apo-8'-zeaxanthinal | ChEBI |
| β-citraurin | ChEBI |
| UniProt Name | Source |
|---|---|
| (3R)-3-hydroxy-8'-apo-β-carotenal | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035091 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2309631 | Reaxys |
| Beilstein:7888297 | Beilstein |
| Citations |
|---|