EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H64N7O17P3S |
| Net Charge | 0 |
| Average Mass | 1003.940 |
| Monoisotopic Mass | 1003.32922 |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C37H64N7O17P3S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-28(46)65-21-20-39-27(45)18-19-40-35(49)32(48)37(2,3)23-58-64(55,56)61-63(53,54)57-22-26-31(60-62(50,51)52)30(47)36(59-26)44-25-43-29-33(38)41-24-42-34(29)44/h9-10,24-26,30-32,36,47-48H,4-8,11-23H2,1-3H3,(H,39,45)(H,40,49)(H,53,54)(H,55,56)(H2,38,41,42)(H2,50,51,52)/b10-9-/t26-,30-,31-,32+,36-/m1/s1 |
| InChIKey | QBYOCCWNZAOZTL-MDMKAECGSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmitoleoyl-CoA (CHEBI:53152) has functional parent palmitoleic acid (CHEBI:28716) |
| palmitoleoyl-CoA (CHEBI:53152) is a 11,12-saturated fatty acyl-CoA (CHEBI:85348) |
| palmitoleoyl-CoA (CHEBI:53152) is a hexadecenoyl-CoA (CHEBI:24549) |
| palmitoleoyl-CoA (CHEBI:53152) is conjugate acid of palmitoleoyl-CoA(4−) (CHEBI:61540) |
| Incoming Relation(s) |
| palmitoleoyl-CoA(4−) (CHEBI:61540) is conjugate base of palmitoleoyl-CoA (CHEBI:53152) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(9Z)-hexadec-9-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| cis-9-hexadecenoyl-CoA | ChEBI |
| cis-9-hexadecenoyl-coenzyme A | ChEBI |
| (Z)-9-hexadecenoyl-CoA | ChEBI |
| palmitoleoyl-coenzyme A | ChEBI |
| palmitoleyl-CoA | ChEBI |
| palmitoleyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006532 | HMDB |
| Citations |
|---|