EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O5 |
| Net Charge | 0 |
| Average Mass | 158.109 |
| Monoisotopic Mass | 158.02152 |
| SMILES | O=C(O)/C=C/C=C(\O)C(=O)O |
| InChI | InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1-3,7H,(H,8,9)(H,10,11)/b3-1+,4-2- |
| InChIKey | JBEBGTMCZIGUTK-TZFCGSKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4E)-2-hydroxymuconic acid (CHEBI:53146) has functional parent muconic acid (CHEBI:38407) |
| (2Z,4E)-2-hydroxymuconic acid (CHEBI:53146) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| (2Z,4E)-2-hydroxymuconic acid (CHEBI:53146) is a hexadienedioic acid (CHEBI:24553) |
| (2Z,4E)-2-hydroxymuconic acid (CHEBI:53146) is conjugate acid of (2Z,4E)-2-hydroxymuconate(2−) (CHEBI:28080) |
| Incoming Relation(s) |
| (2Z,4E)-2-hydroxymuconate(2−) (CHEBI:28080) is conjugate base of (2Z,4E)-2-hydroxymuconic acid (CHEBI:53146) |
| IUPAC Name |
|---|
| (2Z,4E)-2-hydroxyhexa-2,4-dienedioic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6135543 | Beilstein |