EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10NO2Se |
| Net Charge | +1 |
| Average Mass | 183.089 |
| Monoisotopic Mass | 183.98713 |
| SMILES | C[Se]C[C@@H]([NH3+])C(=O)O |
| InChI | InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/p+1/t3-/m1/s1 |
| InChIKey | XDSSPSLGNGIIHP-GSVOUGTGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-methyl-D-selenocysteinium (CHEBI:53131) is a Se-methylselenocysteinium (CHEBI:53132) |
| Se-methyl-D-selenocysteinium (CHEBI:53131) is conjugate acid of Se-methyl-D-selenocysteine (CHEBI:53125) |
| Se-methyl-D-selenocysteinium (CHEBI:53131) is enantiomer of Se-methyl-L-selenocysteinium (CHEBI:53130) |
| Incoming Relation(s) |
| Se-methyl-D-selenocysteine (CHEBI:53125) is conjugate base of Se-methyl-D-selenocysteinium (CHEBI:53131) |
| Se-methyl-L-selenocysteinium (CHEBI:53130) is enantiomer of Se-methyl-D-selenocysteinium (CHEBI:53131) |
| IUPAC Name |
|---|
| (1S)-1-carboxy-2-(methylselanyl)ethanaminium |