EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | COc1cc(O)c2c(=O)c3c(OC)c(O)ccc3oc2c1 |
| InChI | InChI=1S/C15H12O6/c1-19-7-5-9(17)12-11(6-7)21-10-4-3-8(16)15(20-2)13(10)14(12)18/h3-6,16-17H,1-2H3 |
| InChIKey | WYOSCUWDVFHQFY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentianopsis barbata (ncbitaxon:156522) | - | PubMed (14558348) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentiacaulein (CHEBI:5313) has role plant metabolite (CHEBI:76924) |
| gentiacaulein (CHEBI:5313) is a aromatic ether (CHEBI:35618) |
| gentiacaulein (CHEBI:5313) is a polyphenol (CHEBI:26195) |
| gentiacaulein (CHEBI:5313) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 2,8-dihydroxy-1,6-dimethoxy-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 2,8-Dihydroxy-1,6-dimethoxyxanthone | KEGG COMPOUND |
| Citations |
|---|