EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15ClN4O2 |
| Net Charge | 0 |
| Average Mass | 330.775 |
| Monoisotopic Mass | 330.08835 |
| SMILES | Cn1c(=O)c2c(nc(/C=C/c3cccc(Cl)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H15ClN4O2/c1-19-12(8-7-10-5-4-6-11(17)9-10)18-14-13(19)15(22)21(3)16(23)20(14)2/h4-9H,1-3H3/b8-7+ |
| InChIKey | WBWFIUAVMCNYPG-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Biological Roles: | adenosine A2A receptor antagonist An antagonist at the A2A receptor. EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(3-chlorostyryl)caffeine (CHEBI:53115) has functional parent caffeine (CHEBI:27732) |
| 8-(3-chlorostyryl)caffeine (CHEBI:53115) has role adenosine A2A receptor antagonist (CHEBI:53121) |
| 8-(3-chlorostyryl)caffeine (CHEBI:53115) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| 8-(3-chlorostyryl)caffeine (CHEBI:53115) is a monochlorobenzenes (CHEBI:83403) |
| 8-(3-chlorostyryl)caffeine (CHEBI:53115) is a trimethylxanthine (CHEBI:27134) |
| IUPAC Name |
|---|
| 8-[(E)-2-(3-chlorophenyl)ethenyl]-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Synonym | Source |
|---|---|
| CSC | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8153842 | Beilstein |
| CAS:147700-11-6 | SUBMITTER |