EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N6 |
| Net Charge | 0 |
| Average Mass | 318.384 |
| Monoisotopic Mass | 318.15929 |
| SMILES | NC1=C/C(=N\c2ccc(N)cc2)C(N)=C/C1=N\c1ccc(N)cc1 |
| InChI | InChI=1S/C18H18N6/c19-11-1-5-13(6-2-11)23-17-9-16(22)18(10-15(17)21)24-14-7-3-12(20)4-8-14/h1-10H,19-22H2/b23-17+,24-18+ |
| InChIKey | KKJZEUXMWDXPAU-GJHDBBOXSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bandrowski's base (CHEBI:53109) has functional parent 1,4-phenylenediamine (CHEBI:51403) |
| Bandrowski's base (CHEBI:53109) has role allergen (CHEBI:50904) |
| Bandrowski's base (CHEBI:53109) has role mutagen (CHEBI:25435) |
| Bandrowski's base (CHEBI:53109) is a quinone imine (CHEBI:50193) |
| IUPAC Name |
|---|
| N1,N1'-(2,5-diaminocyclohexa-2,5-diene-1,4-diylidene)dibenzene-1,4-diamine |
| Synonyms | Source |
|---|---|
| 3,6-bis[(p-aminophenyl)imino ]cyclohexa-1,4-diene-1,4-diamine | ChEBI |
| 3,6-bis((p-aminophenyl)imino)-1,4-cyclohexadiene-1,4-diamine | ChemIDplus |
| BB | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11464709 | Beilstein |
| Beilstein:2395527 | Beilstein |
| Reaxys:3038033 | Reaxys |
| CAS:20048-27-5 | ChemIDplus |
| Citations |
|---|