EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N6 |
| Net Charge | 0 |
| Average Mass | 318.384 |
| Monoisotopic Mass | 318.15929 |
| SMILES | NC1=C/C(=N\c2ccc(N)cc2)C(N)=C/C1=N\c1ccc(N)cc1 |
| InChI | InChI=1S/C18H18N6/c19-11-1-5-13(6-2-11)23-17-9-16(22)18(10-15(17)21)24-14-7-3-12(20)4-8-14/h1-10H,19-22H2/b23-17+,24-18+ |
| InChIKey | KKJZEUXMWDXPAU-GJHDBBOXSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bandrowski's base (CHEBI:53109) has functional parent 1,4-phenylenediamine (CHEBI:51403) |
| Bandrowski's base (CHEBI:53109) has role allergen (CHEBI:50904) |
| Bandrowski's base (CHEBI:53109) has role mutagen (CHEBI:25435) |
| Bandrowski's base (CHEBI:53109) is a quinone imine (CHEBI:50193) |
| IUPAC Name |
|---|
| N1,N1'-(2,5-diaminocyclohexa-2,5-diene-1,4-diylidene)dibenzene-1,4-diamine |
| Synonyms | Source |
|---|---|
| BB | ChEBI |
| 3,6-bis[(p-aminophenyl)imino ]cyclohexa-1,4-diene-1,4-diamine | ChEBI |
| 3,6-bis((p-aminophenyl)imino)-1,4-cyclohexadiene-1,4-diamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11464709 | Beilstein |
| Beilstein:2395527 | Beilstein |
| Reaxys:3038033 | Reaxys |
| CAS:20048-27-5 | ChemIDplus |
| Citations |
|---|