EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N2 |
| Net Charge | 0 |
| Average Mass | 206.333 |
| Monoisotopic Mass | 206.17830 |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1 |
| InChI | InChI=1S/C13H22N2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13/h12-13H,1-10H2 |
| InChIKey | QOSSAOTZNIDXMA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | ATP synthase inhibitor A mitochondrial respiratory-chain inhibitor that interferes with the action of ATP synthase. |
| Applications: | peptide coupling reagent A reagent used to couple amino acids during artificial peptide synthesis. cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-dicyclohexylcarbodiimide (CHEBI:53090) has role ATP synthase inhibitor (CHEBI:20854) |
| 1,3-dicyclohexylcarbodiimide (CHEBI:53090) has role cross-linking reagent (CHEBI:50684) |
| 1,3-dicyclohexylcarbodiimide (CHEBI:53090) has role peptide coupling reagent (CHEBI:73668) |
| 1,3-dicyclohexylcarbodiimide (CHEBI:53090) is a carbodiimide (CHEBI:53091) |
| IUPAC Name |
|---|
| dicyclohexylmethanediimine |
| Synonyms | Source |
|---|---|
| 1,3-Dicyclohexylcarbodiimide | ChemIDplus |
| Bis(cyclohexyl)carbodiimide | ChemIDplus |
| Carbodicyclohexylimide | NIST Chemistry WebBook |
| DCC | ChemIDplus |
| DCCD | ChemIDplus |
| DCCI | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| N,N'-Dicyclohexylcarbodiimide | Wikipedia |
| Citations |
|---|