EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H7BrO5 |
| Net Charge | 0 |
| Average Mass | 347.120 |
| Monoisotopic Mass | 345.94769 |
| SMILES | O=C(O)c1cc(Br)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H7BrO5/c16-9-5-8(15(20)21)14(19)11-10(9)12(17)6-3-1-2-4-7(6)13(11)18/h1-5,19H,(H,20,21) |
| InChIKey | GRIYMOFQRPRQDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-bromo-1-hydroxyanthraquinone-2-carboxylic acid (CHEBI:53089) is a monocarboxylic acid (CHEBI:25384) |
| 4-bromo-1-hydroxyanthraquinone-2-carboxylic acid (CHEBI:53089) is a monohydroxyanthraquinone (CHEBI:37483) |
| 4-bromo-1-hydroxyanthraquinone-2-carboxylic acid (CHEBI:53089) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| 4-bromo-1-hydroxy-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-bromanyl-1-oxidanyl-9,10-bis(oxidanylidene)anthracene-2-carboxylic acid | ChEBI |
| Az-B | ChEBI |
| Citations |
|---|