EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15NO8 |
| Net Charge | 0 |
| Average Mass | 385.328 |
| Monoisotopic Mass | 385.07977 |
| SMILES | O=C(O)CN(CC(=O)O)Cc1cc2c(c(O)c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H15NO8/c21-13(22)7-20(8-14(23)24)6-9-5-12-15(19(28)16(9)25)18(27)11-4-2-1-3-10(11)17(12)26/h1-5,25,28H,6-8H2,(H,21,22)(H,23,24) |
| InChIKey | PWIGYBONXWGOQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | colorimetric reagent A reagent used in the determination of the concentration of a coloured chemical element or chemical compound in solution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alizarin complexone (CHEBI:53088) has role colorimetric reagent (CHEBI:67126) |
| alizarin complexone (CHEBI:53088) is a dicarboxylic acid (CHEBI:35692) |
| alizarin complexone (CHEBI:53088) is a dihydroxyanthraquinone (CHEBI:37484) |
| IUPAC Name |
|---|
| 2,2'-{[(3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)methyl]imino}diacetic acid |
| Synonyms | Source |
|---|---|
| Alizarin complexone | ChemIDplus |
| {[(3,4-Dihydroxy-2-anthraquinonyl)methyl]imino}diacetic acid dihydrate | ChemIDplus |
| 1,2-Dihydroxy-anthrachinon-3-methylen-iminodiessigsaeure | ChemIDplus |
| 3-Aminomethylalizarin-N,N-diacetic acid | ChemIDplus |
| Alizarin Fluorine Blue | ChemIDplus |
| Alizarin complexon | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2190028 | Beilstein |
| Gmelin:63214 | Gmelin |
| CAS:3952-78-1 | ChemIDplus |
| Citations |
|---|