EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N3O6 |
| Net Charge | 0 |
| Average Mass | 281.224 |
| Monoisotopic Mass | 281.06479 |
| SMILES | O=C(O)[C@@H]1CCCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N3O6/c15-11(16)9-2-1-5-12(9)8-4-3-7(13(17)18)6-10(8)14(19)20/h3-4,6,9H,1-2,5H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | MVZXUWLTGGBNHL-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,4-dinitrophenyl)-L-proline (CHEBI:53086) is a C-nitro compound (CHEBI:35716) |
| N-(2,4-dinitrophenyl)-L-proline (CHEBI:53086) is a L-proline derivative (CHEBI:84186) |
| N-(2,4-dinitrophenyl)-L-proline (CHEBI:53086) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| N-(2,4-dinitrophenyl)-L-proline (CHEBI:53086) is a pyrrolidines (CHEBI:38260) |
| IUPAC Name |
|---|
| 1-(2,4-dinitrophenyl)-L-proline |
| Synonyms | Source |
|---|---|
| 1-(2,4-Dinitrophenyl)-L-proline | ChemIDplus |
| DNP-Pro | ChEBI |
| DNP-L-Pro | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:93597 | Beilstein |
| Beilstein:5608202 | Beilstein |
| CAS:1655-55-6 | ChemIDplus |
| Citations |
|---|