EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO3 |
| Net Charge | 0 |
| Average Mass | 217.224 |
| Monoisotopic Mass | 217.07389 |
| SMILES | [H]C(OCC)=C1N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C12H11NO3/c1-2-15-8-10-12(14)16-11(13-10)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | SJHPCNCNNSSLPL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(ethoxymethylene)-2-phenyloxazol-5-one (CHEBI:53076) has role allergen (CHEBI:50904) |
| 4-(ethoxymethylene)-2-phenyloxazol-5-one (CHEBI:53076) is a 1,3-oxazoles (CHEBI:46812) |
| 4-(ethoxymethylene)-2-phenyloxazol-5-one (CHEBI:53076) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5(4H)-one |
| Synonyms | Source |
|---|---|
| oxazolone | ChEBI |
| 4-Ethoxymethylene-2-phenyl-2-oxazoline-5-one | ChemIDplus |
| OXA | ChEBI |
| phenyl Ox | ChEBI |
| 2-phenyl-4-ethoxymethylene-5-oxazolone | ChEBI |
| 2-phenyl-oxazolone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Oxazolone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:163055 | Reaxys |
| CAS:15646-46-5 | ChemIDplus |
| Citations |
|---|