EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53074 - diphenylcyclopropenone
| Formula | C15H10O |
| Net Charge | 0 |
| Average Mass | 206.244 |
| Monoisotopic Mass | 206.07316 |
| SMILES | O=c1c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | HCIBTBXNLVOFER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylcyclopropenone (CHEBI:53074) has role drug allergen (CHEBI:88188) |
| diphenylcyclopropenone (CHEBI:53074) has role hapten (CHEBI:59174) |
| diphenylcyclopropenone (CHEBI:53074) has role photosensitizing agent (CHEBI:47868) |
| diphenylcyclopropenone (CHEBI:53074) is a cyclopropenone (CHEBI:53075) |
| IUPAC Name |
|---|
| 2,3-diphenylcycloprop-2-en-1-one |
| Synonyms | Source |
|---|---|
| Diphenylcyclopropenone | ChemIDplus |
| Diphencyprone | ChemIDplus |
| 2,3-Diphenylcyclopropenone | ChemIDplus |
| 2,3-Diphenylcycloprop-2-en-1-one | ChemIDplus |
| DPC | NIST Chemistry WebBook |
| DPCP | ChEBI |
| Citations |
|---|