EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:53074 - diphenylcyclopropenone
| Formula | C15H10O |
| Net Charge | 0 |
| Average Mass | 206.244 |
| Monoisotopic Mass | 206.07316 |
| SMILES | O=c1c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | HCIBTBXNLVOFER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylcyclopropenone (CHEBI:53074) has role drug allergen (CHEBI:88188) |
| diphenylcyclopropenone (CHEBI:53074) has role hapten (CHEBI:59174) |
| diphenylcyclopropenone (CHEBI:53074) has role photosensitizing agent (CHEBI:47868) |
| diphenylcyclopropenone (CHEBI:53074) is a cyclopropenone (CHEBI:53075) |
| IUPAC Name |
|---|
| 2,3-diphenylcycloprop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 2,3-Diphenylcycloprop-2-en-1-one | ChemIDplus |
| 2,3-Diphenylcyclopropenone | ChemIDplus |
| diphencyprone | ChEMBL |
| Diphencyprone | ChemIDplus |
| Diphenylcyclopenone | ChEMBL |
| Diphenylcyclopropenone | ChemIDplus |
| Citations |
|---|