EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3N3O9S |
| Net Charge | 0 |
| Average Mass | 293.169 |
| Monoisotopic Mass | 292.95900 |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(S(=O)(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O9S/c10-7(11)3-1-4(8(12)13)6(19(16,17)18)5(2-3)9(14)15/h1-2H,(H,16,17,18) |
| InChIKey | NHJVRSWLHSJWIN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| Application: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trinitrobenzenesulfonic acid (CHEBI:53063) has role epitope (CHEBI:53000) |
| 2,4,6-trinitrobenzenesulfonic acid (CHEBI:53063) has role explosive (CHEBI:63490) |
| 2,4,6-trinitrobenzenesulfonic acid (CHEBI:53063) has role reagent (CHEBI:33893) |
| 2,4,6-trinitrobenzenesulfonic acid (CHEBI:53063) is a C-nitro compound (CHEBI:35716) |
| 2,4,6-trinitrobenzenesulfonic acid (CHEBI:53063) is a arenesulfonic acid (CHEBI:33555) |
| IUPAC Name |
|---|
| 2,4,6-trinitrobenzenesulfonic acid |
| Synonyms | Source |
|---|---|
| Trinitrobenzenesulfonic acid | ChemIDplus |
| 2,4,6-Trinitrobenzenesulfonic acid | ChemIDplus |
| 2,4,6-Trinitrobenzene-1-sulfonic acid | ChemIDplus |
| Picryl sulfonic acid | ChemIDplus |
| TNBS | ChEBI |
| picrylsulfonic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2,4,6-Trinitrobenzenesulfonic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1051138 | Gmelin |
| Reaxys:572358 | Reaxys |
| CAS:2508-19-2 | ChemIDplus |
| Citations |
|---|