EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2ClN3O6 |
| Net Charge | 0 |
| Average Mass | 247.550 |
| Monoisotopic Mass | 246.96321 |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H2ClN3O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H |
| InChIKey | HJRJRUMKQCMYDL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-chloro-2,4,6-trinitrobenzene (CHEBI:53053) has role allergen (CHEBI:50904) |
| 1-chloro-2,4,6-trinitrobenzene (CHEBI:53053) has role epitope (CHEBI:53000) |
| 1-chloro-2,4,6-trinitrobenzene (CHEBI:53053) has role explosive (CHEBI:63490) |
| 1-chloro-2,4,6-trinitrobenzene (CHEBI:53053) has role hapten (CHEBI:59174) |
| 1-chloro-2,4,6-trinitrobenzene (CHEBI:53053) is a C-nitro compound (CHEBI:35716) |
| 1-chloro-2,4,6-trinitrobenzene (CHEBI:53053) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-chloro-1,3,5-trinitrobenzene |
| Synonyms | Source |
|---|---|
| 1-Chloro-2,4,6-trinitrobenzene | ChemIDplus |
| 2,4,6-Trinitro-1-chlorobenzene | ChemIDplus |
| 2,4,6-Trinitrochlorobenzene | ChemIDplus |
| 2-Chloro-1,3,5-trinitrobenzene | ChemIDplus |
| Picryl chloride | ChemIDplus |
| Tncb | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Picryl_chloride | Wikipedia |
| Citations |
|---|