EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3N3O4S |
| Net Charge | 0 |
| Average Mass | 225.185 |
| Monoisotopic Mass | 224.98443 |
| SMILES | N#CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H |
| InChIKey | XQDQRCRASHAZBA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. tolerogen A substance that invokes a specific immune non-responsiveness due to its molecular form. If its molecular form is changed, a tolerogen can become an immunogen. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dinitro-1-thiocyanatobenzene (CHEBI:53051) has role hapten (CHEBI:59174) |
| 2,4-dinitro-1-thiocyanatobenzene (CHEBI:53051) has role tolerogen (CHEBI:73623) |
| 2,4-dinitro-1-thiocyanatobenzene (CHEBI:53051) is a C-nitro compound (CHEBI:35716) |
| 2,4-dinitro-1-thiocyanatobenzene (CHEBI:53051) is a thiocyanates (CHEBI:26955) |
| IUPAC Name |
|---|
| 2,4-dinitrophenyl thiocyanate |
| Synonyms | Source |
|---|---|
| 2,4-Dinitrothiocyanatobenzene | ChemIDplus |
| 2,4-Dinitro-1-thiocyanobenzene | ChemIDplus |
| 2,4-Dinitro-rhodanbenzol | ChemIDplus |
| 2,4-Dinitrophenyl thiocyanate | ChemIDplus |
| 2,4-Dinitrothiocyanatebenzene | ChemIDplus |
| 2,4-Dinitrothiocyanobenzene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1983292 | Reaxys |
| CAS:1594-56-5 | ChemIDplus |
| Citations |
|---|