EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3FN2O4 |
| Net Charge | 0 |
| Average Mass | 186.098 |
| Monoisotopic Mass | 186.00768 |
| SMILES | O=[N+]([O-])c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3FN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H |
| InChIKey | LOTKRQAVGJMPNV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.3.2 (creatine kinase) inhibitor An EC 2.7.3.* (phosphotransferases with a nitrogenous group as acceptor) inhibitor that interferes with the action of creatine kinase, EC 2.7.3.2. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Applications: | chromatographic reagent A reagent used to improve selectivity in chromatographic analyses or separations, e.g. by formation of a derivative or by modification of the mobile phase. protein-sequencing agent Any agent used to determine the amino-acid sequence in a polypeptide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. spectrophotometric reagent A reagent used in the determination by spectrophotometry of the concentration of a chemical element or chemical compound in solution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role agrochemical (CHEBI:33286) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role allergen (CHEBI:50904) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role chromatographic reagent (CHEBI:59745) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role EC 2.7.3.2 (creatine kinase) inhibitor (CHEBI:73354) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role protein-sequencing agent (CHEBI:73352) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role spectrophotometric reagent (CHEBI:73618) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) is a C-nitro compound (CHEBI:35716) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 1-fluoro-2,4-dinitrobenzene |
| Synonyms | Source |
|---|---|
| 1,2,4-Fluorodinitrobenzene | NIST Chemistry WebBook |
| 1-Fluoro-2,4-dinitrobenzene | ChemIDplus |
| 2,4-Dinitro-1-fluorobenzene | ChemIDplus |
| 2,4-Dinitrobenzene fluoride | ChemIDplus |
| 2,4-Dinitrobenzenefluoride | ChemIDplus |
| 2,4-Dinitrofluorobenzene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1-Fluoro-2,4-dinitrobenzene | Wikipedia |
| CPD-8983 | MetaCyc |
| Citations |
|---|