EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3FN2O4 |
| Net Charge | 0 |
| Average Mass | 186.098 |
| Monoisotopic Mass | 186.00768 |
| SMILES | O=[N+]([O-])c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3FN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H |
| InChIKey | LOTKRQAVGJMPNV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. EC 2.7.3.2 (creatine kinase) inhibitor An EC 2.7.3.* (phosphotransferases with a nitrogenous group as acceptor) inhibitor that interferes with the action of creatine kinase, EC 2.7.3.2. |
| Applications: | protein-sequencing agent Any agent used to determine the amino-acid sequence in a polypeptide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. spectrophotometric reagent A reagent used in the determination by spectrophotometry of the concentration of a chemical element or chemical compound in solution. chromatographic reagent A reagent used to improve selectivity in chromatographic analyses or separations, e.g. by formation of a derivative or by modification of the mobile phase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role agrochemical (CHEBI:33286) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role allergen (CHEBI:50904) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role chromatographic reagent (CHEBI:59745) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role EC 2.7.3.2 (creatine kinase) inhibitor (CHEBI:73354) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role protein-sequencing agent (CHEBI:73352) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) has role spectrophotometric reagent (CHEBI:73618) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) is a C-nitro compound (CHEBI:35716) |
| 1-fluoro-2,4-dinitrobenzene (CHEBI:53049) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 1-fluoro-2,4-dinitrobenzene |
| Synonyms | Source |
|---|---|
| 1,2,4-Fluorodinitrobenzene | NIST Chemistry WebBook |
| 1-Fluoro-2,4-dinitrobenzene | ChemIDplus |
| 2,4-Dinitro-1-fluorobenzene | ChemIDplus |
| 2,4-Dinitrobenzene fluoride | ChemIDplus |
| 2,4-Dinitrobenzenefluoride | ChemIDplus |
| 2,4-Dinitrofluorobenzene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1-Fluoro-2,4-dinitrobenzene | Wikipedia |
| CPD-8983 | MetaCyc |
| Citations |
|---|