EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4 |
| Net Charge | 0 |
| Average Mass | 204.226 |
| Monoisotopic Mass | 204.11101 |
| SMILES | N[C@@H](CCCCNCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4/c9-6(8(13)14)3-1-2-4-10-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14)/t6-/m0/s1 |
| InChIKey | NUXSIDPKKIEIMI-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-carboxymethyl-L-lysine (CHEBI:53014) has role antigen (CHEBI:59132) |
| N6-carboxymethyl-L-lysine (CHEBI:53014) is a L-lysine derivative (CHEBI:25095) |
| N6-carboxymethyl-L-lysine (CHEBI:53014) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| N6-carboxymethyl-L-lysine residue (CHEBI:53015) is substituent group from N6-carboxymethyl-L-lysine (CHEBI:53014) |
| IUPAC Name |
|---|
| N6-(carboxymethyl)-L-lysine |
| Synonyms | Source |
|---|---|
| Nε-carboxymethyl-L-lysine | ChEBI |
| N(6)-Carboxymethyllysine | ChemIDplus |
| NECML | ChemIDplus |
| N(epsilon)-(Carboxymethyl)lysine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4989963 | Reaxys |
| CAS:5746-04-3 | ChemIDplus |
| Citations |
|---|