EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N3O8P |
| Net Charge | 0 |
| Average Mass | 323.198 |
| Monoisotopic Mass | 323.05185 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-6(14)7(4(3-13)19-8)20-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | UOOOPKANIPLQPU-XVFCMESISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-CMP (CHEBI:53013) has role Escherichia coli metabolite (CHEBI:76971) |
| 3'-CMP (CHEBI:53013) has role metabolite (CHEBI:25212) |
| 3'-CMP (CHEBI:53013) has role mouse metabolite (CHEBI:75771) |
| 3'-CMP (CHEBI:53013) is a cytidine 3'-phosphate (CHEBI:23518) |
| 3'-CMP (CHEBI:53013) is a pyrimidine ribonucleoside 3'-monophosphate (CHEBI:37018) |
| 3'-CMP (CHEBI:53013) is conjugate acid of 3'-CMP(2−) (CHEBI:60875) |
| Incoming Relation(s) |
| cytidylyl-(3'→5')-guanosine (CHEBI:167896) has functional parent 3'-CMP (CHEBI:53013) |
| 3'-CMP(2−) (CHEBI:60875) is conjugate base of 3'-CMP (CHEBI:53013) |
| IUPAC Name |
|---|
| 3'-cytidylic acid |
| Synonyms | Source |
|---|---|
| 3'-CMP | KEGG COMPOUND |
| 3'-Cytidylic acid | ChemIDplus |
| Cytidine 3'-monophosphate | ChemIDplus |
| Cytidine-3'-Monophosphate | DrugBank |
| CYTIDINE-3'-MONOPHOSPHATE | PDB |
| Cytidine 3'-phosphate | KEGG COMPOUND |
| Citations |
|---|