EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N3O8P |
| Net Charge | 0 |
| Average Mass | 323.198 |
| Monoisotopic Mass | 323.05185 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-6(14)7(4(3-13)19-8)20-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | UOOOPKANIPLQPU-XVFCMESISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-CMP (CHEBI:53013) has role Escherichia coli metabolite (CHEBI:76971) |
| 3'-CMP (CHEBI:53013) has role metabolite (CHEBI:25212) |
| 3'-CMP (CHEBI:53013) has role mouse metabolite (CHEBI:75771) |
| 3'-CMP (CHEBI:53013) is a cytidine 3'-phosphate (CHEBI:23518) |
| 3'-CMP (CHEBI:53013) is a pyrimidine ribonucleoside 3'-monophosphate (CHEBI:37018) |
| 3'-CMP (CHEBI:53013) is conjugate acid of 3'-CMP(2−) (CHEBI:60875) |
| Incoming Relation(s) |
| cytidylyl-(3'→5')-guanosine (CHEBI:167896) has functional parent 3'-CMP (CHEBI:53013) |
| 3'-CMP(2−) (CHEBI:60875) is conjugate base of 3'-CMP (CHEBI:53013) |
| IUPAC Name |
|---|
| 3'-cytidylic acid |
| Synonyms | Source |
|---|---|
| 3'-CMP | KEGG COMPOUND |
| 3'-Cytidylic acid | ChemIDplus |
| Cytidine 3'-monophosphate | ChemIDplus |
| Cytidine-3'-Monophosphate | DrugBank |
| CYTIDINE-3'-MONOPHOSPHATE | PDB |
| Cytidine 3'-phosphate | KEGG COMPOUND |
| Citations |
|---|