EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2 |
| Net Charge | 0 |
| Average Mass | 158.204 |
| Monoisotopic Mass | 158.08440 |
| SMILES | Nc1cccc2c(N)cccc12 |
| InChI | InChI=1S/C10H10N2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6H,11-12H2 |
| InChIKey | KQSABULTKYLFEV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthalene-1,5-diamine (CHEBI:53003) has role carcinogenic agent (CHEBI:50903) |
| naphthalene-1,5-diamine (CHEBI:53003) is a naphthalenediamine (CHEBI:53009) |
| IUPAC Name |
|---|
| naphthalene-1,5-diamine |
| Synonyms | Source |
|---|---|
| 1,5-naphthalenediamine | SUBMITTER |
| 1,5-diaminonaphthalene | SUBMITTER |
| 1,5-Naphthalenediamine | ChemIDplus |
| 1,5-Diaminonaphthalene | ChemIDplus |
| 1,5-Naphthylenediamine | ChemIDplus |