EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H37NO6 |
| Net Charge | 0 |
| Average Mass | 507.627 |
| Monoisotopic Mass | 507.26209 |
| SMILES | [H][C@]12[C@H](Cc3ccccc3)NC(=O)[C@@]13C(/C=C/C[C@H](C)C(=O)[C@](C)(O)/C=C/[C@H]3OC(C)=O)[C@H](O)C(=C)[C@H]2C |
| InChI | InChI=1S/C30H37NO6/c1-17-10-9-13-22-26(33)19(3)18(2)25-23(16-21-11-7-6-8-12-21)31-28(35)30(22,25)24(37-20(4)32)14-15-29(5,36)27(17)34/h6-9,11-15,17-18,22-26,33,36H,3,10,16H2,1-2,4-5H3,(H,31,35)/b13-9+,15-14+/t17-,18+,22?,23-,24+,25-,26+,29+,30+/m0/s1 |
| InChIKey | SDZRWUKZFQQKKV-FJUULPFHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | actin polymerisation inhibitor Any substance that inhibits the polymerisation of the protein actin. mycotoxin Poisonous substance produced by fungi. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytochalasin D (CHEBI:529996) has role actin polymerisation inhibitor (CHEBI:70728) |
| cytochalasin D (CHEBI:529996) has role antineoplastic agent (CHEBI:35610) |
| cytochalasin D (CHEBI:529996) has role DNA synthesis inhibitor (CHEBI:59517) |
| cytochalasin D (CHEBI:529996) has role mycotoxin (CHEBI:25442) |
| cytochalasin D (CHEBI:529996) is a acetate ester (CHEBI:47622) |
| cytochalasin D (CHEBI:529996) is a alkaloid (CHEBI:22315) |
| cytochalasin D (CHEBI:529996) is a cyclic ketone (CHEBI:3992) |
| cytochalasin D (CHEBI:529996) is a cytochalasin (CHEBI:23528) |
| cytochalasin D (CHEBI:529996) is a organic heterotricyclic compound (CHEBI:26979) |
| cytochalasin D (CHEBI:529996) is a secondary alcohol (CHEBI:35681) |
| cytochalasin D (CHEBI:529996) is a tertiary alcohol (CHEBI:26878) |
| cytochalasin D (CHEBI:529996) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| cytochalasin D (CHEBI:529996) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| (3S,3aR,4S,6S,7E,10S,12R,13E,15R,15aR)-3-benzyl-6,12-dihydroxy-4,10,12-trimethyl-5-methylene-1,11-dioxo-2,3,3a,4,5,6,6a,9,10,11,12,15-dodecahydro-1H-cycloundeca[d]isoindol-15-yl acetate |
| Synonyms | Source |
|---|---|
| Zygosporin A | ChemIDplus |
| Cytohalasin D | ChemIDplus |
| Lygosporin A | ChemIDplus |
| 7,18-Dihydroxy-10-phenyl-5,16,18-trimethyl-(11)cytochalas-21-acetoxy-6(12),13,19-trien-17-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Cytochalasin_D | Wikipedia |
| CY9 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1632828 | Reaxys |
| CAS:22144-77-0 | ChemIDplus |
| Citations |
|---|