EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O7P |
| Net Charge | 0 |
| Average Mass | 345.208 |
| Monoisotopic Mass | 345.04743 |
| SMILES | Nc1nc2c(c(=O)n1)NC1C(=O)C3OP(=O)(O)OCC3OC1N2 |
| InChI | InChI=1S/C10H12N5O7P/c11-10-14-7-4(8(17)15-10)12-3-5(16)6-2(21-9(3)13-7)1-20-23(18,19)22-6/h2-3,6,9,12H,1H2,(H,18,19)(H4,11,13,14,15,17) |
| InChIKey | PWFXLXMPGSLEOZ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| precursor Z (CHEBI:52994) is a organic heterotetracyclic compound (CHEBI:38163) |
| precursor Z (CHEBI:52994) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| precursor Z (CHEBI:52994) is a oxacycle (CHEBI:38104) |
| precursor Z (CHEBI:52994) is conjugate acid of precursor Z(1−) (CHEBI:59648) |
| Incoming Relation(s) |
| precursor Z(1−) (CHEBI:59648) is conjugate base of precursor Z (CHEBI:52994) |
| IUPAC Name |
|---|
| 8-amino-2-hydroxy-4a,5a,9,11,11a,12a-hexahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine-10,12(4H,6H)-dione 2-oxide |
| Synonyms | Source |
|---|---|
| cPMP | ChEBI |
| cyclic pyranopterin monophosphate | ChEBI |
| Citations |
|---|