EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5298 - Genipin
| Formula | C11H14O5 |
| Net Charge | 0 |
| Average Mass | 226.228 |
| Monoisotopic Mass | 226.08412 |
| SMILES | [H][C@@]12C(CO)=CC[C@]1([H])C(C(=O)OC)=CO[C@H]2O |
| InChI | InChI=1S/C11H14O5/c1-15-10(13)8-5-16-11(14)9-6(4-12)2-3-7(8)9/h2,5,7,9,11-12,14H,3-4H2,1H3/t7-,9-,11-/m1/s1 |
| InChIKey | AZKVWQKMDGGDSV-BCMRRPTOSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | uncoupling protein inhibitor Any inhibitor that acts on uncoupling protein. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Genipin (CHEBI:5298) has role anti-inflammatory agent (CHEBI:67079) |
| Genipin (CHEBI:5298) has role antioxidant (CHEBI:22586) |
| Genipin (CHEBI:5298) has role apoptosis inhibitor (CHEBI:68494) |
| Genipin (CHEBI:5298) has role cross-linking reagent (CHEBI:50684) |
| Genipin (CHEBI:5298) has role hepatotoxic agent (CHEBI:50908) |
| Genipin (CHEBI:5298) has role uncoupling protein inhibitor (CHEBI:145437) |
| Genipin (CHEBI:5298) is a iridoid monoterpenoid (CHEBI:50563) |
| Synonym | Source |
|---|---|
| Genipin | KEGG COMPOUND |
| Citations |
|---|