EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O5 |
| Net Charge | 0 |
| Average Mass | 190.195 |
| Monoisotopic Mass | 190.08412 |
| SMILES | COC(=O)C(O)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C8H14O5/c1-4(2)5(7(10)11)6(9)8(12)13-3/h4-6,9H,1-3H3,(H,10,11) |
| InChIKey | YFUPBIBIDVFELV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-2-isopropyl-4-methoxy-4-oxobutanoic acid (CHEBI:52978) has functional parent succinic acid (CHEBI:15741) |
| 3-hydroxy-2-isopropyl-4-methoxy-4-oxobutanoic acid (CHEBI:52978) is a dicarboxylic acid monoester (CHEBI:36244) |
| 3-hydroxy-2-isopropyl-4-methoxy-4-oxobutanoic acid (CHEBI:52978) is a methyl ester (CHEBI:25248) |
| 3-hydroxy-2-isopropyl-4-methoxy-4-oxobutanoic acid (CHEBI:52978) is conjugate acid of 3-hydroxy-2-isopropyl-4-methoxy-4-oxobutanoate (CHEBI:52960) |
| Incoming Relation(s) |
| 3-hydroxy-2-isopropyl-4-methoxy-4-oxobutanoate (CHEBI:52960) is conjugate base of 3-hydroxy-2-isopropyl-4-methoxy-4-oxobutanoic acid (CHEBI:52978) |
| IUPAC Name |
|---|
| 3-hydroxy-2-isopropyl-4-methoxy-4-oxobutanoic acid |