EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H73NO9 |
| Net Charge | 0 |
| Average Mass | 688.000 |
| Monoisotopic Mass | 687.52853 |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)[C@H](CO[C@H]1O[C@H](C(=O)O)[C@H](O)[C@H](O)[C@H]1O)NC(=O)CCCCCCCCCCCCC |
| InChI | InChI=1S/C38H73NO9/c1-3-5-7-9-11-13-15-16-18-19-21-23-25-27-31(40)30(29-47-38-35(44)33(42)34(43)36(48-38)37(45)46)39-32(41)28-26-24-22-20-17-14-12-10-8-6-4-2/h30-31,33-36,38,40,42-44H,3-29H2,1-2H3,(H,39,41)(H,45,46)/t30-,31+,33-,34+,35+,36-,38-/m0/s1 |
| InChIKey | IRPOZWRRAFKYMQ-LMIAXWKISA-N |
| Roles Classification |
|---|
| Biological Roles: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-(α-D-galactopyranuronosyl)-N-tetradecanoyldihydrosphingosine (CHEBI:528825) has role antigen (CHEBI:59132) |
| 1-O-(α-D-galactopyranuronosyl)-N-tetradecanoyldihydrosphingosine (CHEBI:528825) has role epitope (CHEBI:53000) |
| 1-O-(α-D-galactopyranuronosyl)-N-tetradecanoyldihydrosphingosine (CHEBI:528825) is a glycodihydroceramide (CHEBI:60451) |
| IUPAC Name |
|---|
| (2S,3R)-3-hydroxy-2-(tetradecanoylamino)octadecyl α-D-galactopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| GalA-GSL | ChEBI |
| GSL-1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| GSL | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10232866 | Beilstein |
| Reaxys:10232866 | Reaxys |
| Citations |
|---|