EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24N3S |
| Net Charge | +1 |
| Average Mass | 386.544 |
| Monoisotopic Mass | 386.16855 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C24H24N3S/c1-26(2)22-13-7-19(8-14-22)24(18-5-11-21(12-6-18)25-17-28)20-9-15-23(16-10-20)27(3)4/h5-16H,1-4H3/q+1 |
| InChIKey | WAGQVEJKLAIRPI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malachite green isothiocyanate cation (CHEBI:52870) has role fluorochrome (CHEBI:51217) |
| malachite green isothiocyanate cation (CHEBI:52870) is a iminium ion (CHEBI:35286) |
| malachite green isothiocyanate cation (CHEBI:52870) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| malachite green isothiocyanate (CHEBI:52122) has part malachite green isothiocyanate cation (CHEBI:52870) |
| IUPAC Name |
|---|
| N-(4-{[4-(dimethylamino)phenyl](4-isothiocyanatophenyl)methylidene}cyclohexa-2,5-dien-1-ylidene)-N-methylmethanaminium |
| Synonym | Source |
|---|---|
| malachite green isothiocyanate(1+) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6938342 | Beilstein |