EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N3 |
| Net Charge | +1 |
| Average Mass | 372.536 |
| Monoisotopic Mass | 372.24342 |
| SMILES | [H]C(=Cc1ccc(N(C)C)cc1)C=C([H])c1ccc2cc(N(C)C)ccc2[n+]1CC |
| InChI | InChI=1S/C25H30N3/c1-6-28-23(16-13-21-19-24(27(4)5)17-18-25(21)28)10-8-7-9-20-11-14-22(15-12-20)26(2)3/h7-19H,6H2,1-5H3/q+1 |
| InChIKey | BCVRWZODRSBEQZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LDS 751(1+) (CHEBI:52865) has role fluorochrome (CHEBI:51217) |
| LDS 751(1+) (CHEBI:52865) is a quinolinium ion (CHEBI:52837) |
| LDS 751(1+) (CHEBI:52865) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| LDS 751 dye (CHEBI:52100) has part LDS 751(1+) (CHEBI:52865) |
| IUPAC Name |
|---|
| 6-(dimethylamino)-2-{4-[4-(dimethylamino)phenyl]buta-1,3-dien-1-yl}-1-ethylquinolinium |
| Synonym | Source |
|---|---|
| LDS 751 cation | ChEBI |