EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N2S |
| Net Charge | +1 |
| Average Mass | 335.496 |
| Monoisotopic Mass | 335.15765 |
| SMILES | [H]C(=Cc1sc2ccccc2[n+]1CC)C=C([H])c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H23N2S/c1-4-23-19-10-6-7-11-20(19)24-21(23)12-8-5-9-17-13-15-18(16-14-17)22(2)3/h5-16H,4H2,1-3H3/q+1 |
| InChIKey | NRPYYACQUPIKLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| exciton(1+) (CHEBI:52864) has role fluorochrome (CHEBI:51217) |
| exciton(1+) (CHEBI:52864) is a benzothiazolium ion (CHEBI:52838) |
| exciton(1+) (CHEBI:52864) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| exciton (CHEBI:52099) has part exciton(1+) (CHEBI:52864) |
| IUPAC Name |
|---|
| 2-{4-[4-(dimethylamino)phenyl]buta-1,3-dien-1-yl}-3-ethyl-1,3-benzothiazol-3-ium |
| Synonym | Source |
|---|---|
| exciton cation | ChEBI |