EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H53N3 |
| Net Charge | +2 |
| Average Mass | 503.819 |
| Monoisotopic Mass | 503.42285 |
| SMILES | [H]C(=CC([H])=Cc1cc[n+](CCC[N+](CC)(CC)CC)cc1)C=C([H])c1ccc(N(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C34H53N3/c1-6-11-27-36(28-12-7-2)34-22-20-32(21-23-34)18-15-13-14-16-19-33-24-29-35(30-25-33)26-17-31-37(8-3,9-4)10-5/h13-16,18-25,29-30H,6-12,17,26-28,31H2,1-5H3/q+2 |
| InChIKey | JGVVSBSPWPPLRS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FM 4-64(2+) (CHEBI:52856) has role fluorochrome (CHEBI:51217) |
| FM 4-64(2+) (CHEBI:52856) is a pyridinium ion (CHEBI:50334) |
| FM 4-64(2+) (CHEBI:52856) is a quaternary ammonium ion (CHEBI:35267) |
| FM 4-64(2+) (CHEBI:52856) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| FM 4-64 dye (CHEBI:52078) has part FM 4-64(2+) (CHEBI:52856) |
| IUPAC Name |
|---|
| 4-{6-[4-(dibutylamino)phenyl]hexa-1,3,5-trien-1-yl}-1-[3-(triethylammonio)propyl]pyridinium |