EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H49N3 |
| Net Charge | +2 |
| Average Mass | 451.743 |
| Monoisotopic Mass | 451.39155 |
| SMILES | [H]C(=Cc1cc[n+](CCC[N+](CC)(CC)CC)cc1)c1ccc(N(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C30H49N3/c1-6-11-23-32(24-12-7-2)30-18-16-28(17-19-30)14-15-29-20-25-31(26-21-29)22-13-27-33(8-3,9-4)10-5/h14-21,25-26H,6-13,22-24,27H2,1-5H3/q+2 |
| InChIKey | OKZXHSSXTVFTDR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FM 1-43(2+) (CHEBI:52850) has role fluorochrome (CHEBI:51217) |
| FM 1-43(2+) (CHEBI:52850) is a pyridinium ion (CHEBI:50334) |
| FM 1-43(2+) (CHEBI:52850) is a quaternary ammonium ion (CHEBI:35267) |
| FM 1-43(2+) (CHEBI:52850) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| FM 1-43 dye (CHEBI:52077) has part FM 1-43(2+) (CHEBI:52850) |
| IUPAC Name |
|---|
| 4-{2-[4-(dibutylamino)phenyl]ethenyl}-1-[3-(triethylammonio)propyl]pyridinium |