EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5280 - gatifloxacin
| Formula | C19H22FN3O4 |
| Net Charge | 0 |
| Average Mass | 375.400 |
| Monoisotopic Mass | 375.15943 |
| SMILES | COc1c(N2CCNC(C)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C19H22FN3O4/c1-10-8-22(6-5-21-10)16-14(20)7-12-15(18(16)27-2)23(11-3-4-11)9-13(17(12)24)19(25)26/h7,9-11,21H,3-6,8H2,1-2H3,(H,25,26) |
| InChIKey | XUBOMFCQGDBHNK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gatifloxacin (CHEBI:5280) has role anti-ulcer drug (CHEBI:49201) |
| gatifloxacin (CHEBI:5280) has role antibacterial agent (CHEBI:33282) |
| gatifloxacin (CHEBI:5280) has role antiinfective agent (CHEBI:35441) |
| gatifloxacin (CHEBI:5280) has role antimicrobial agent (CHEBI:33281) |
| gatifloxacin (CHEBI:5280) has role antitubercular agent (CHEBI:33231) |
| gatifloxacin (CHEBI:5280) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| gatifloxacin (CHEBI:5280) has role ophthalmology drug (CHEBI:66981) |
| gatifloxacin (CHEBI:5280) is a N-arylpiperazine (CHEBI:46848) |
| gatifloxacin (CHEBI:5280) is a organofluorine compound (CHEBI:37143) |
| gatifloxacin (CHEBI:5280) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| gatifloxacin (CHEBI:5280) is a quinolone (CHEBI:23765) |
| gatifloxacin (CHEBI:5280) is a quinolone antibiotic (CHEBI:86324) |
| Incoming Relation(s) |
| (R)-gatifloxacin (CHEBI:53560) is a gatifloxacin (CHEBI:5280) |
| (S)-gatifloxacin (CHEBI:53562) is a gatifloxacin (CHEBI:5280) |
| IUPAC Name |
|---|
| 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| gatifloxacin | KEGG DRUG |
| gatifloxacine | WHO MedNet |
| gatifloxacino | WHO MedNet |
| gatifloxacinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-Cyclopropyl-1,4-dihydro-6-fluoro-8-methoxy-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid | ChemIDplus |
| 1-cyclopropyl-6-fluoro- 8-methoxy-7-(3-methylpiperazin-1-yl)- 4-oxo-quinoline-3-carboxylic acid | ChEMBL |
| AM 1155 | KEGG COMPOUND |
| AM-1155 | ChEMBL |
| BMS-206584-01 | ChEMBL |
| BMS-20658401 | ChEMBL |
| Brand Names | Source |
|---|---|
| Tequin | ChEMBL |
| Zymar | ChEMBL |
| Zymaxid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2281206 | Gmelin |
| Reaxys:7445861 | Reaxys |
| CAS:112811-59-3 | ChemIDplus |
| CAS:112811-59-3 | KEGG COMPOUND |
| CAS:112811-59-3 | DrugBank |
| Citations |
|---|